C28H30N2O3 — CID 129360854
N-methyl-1-(2-phenoxyacetyl)-4-[(3-phenylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 129360854) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-methyl-1-(2-phenoxyacetyl)-4-[(3-phenylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-methyl-1-(2-phenoxyacetyl)-4-[(3-phenylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 129360854 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-methyl-1-(2-phenoxyacetyl)-4-[(3-phenylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C1(Cc2cccc(-c3ccccc3)c2)CCN(C(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C28H30N2O3/c1-29-27(32)28(20-22-9-8-12-24(19-22)23-10-4-2-5-11-23)15-17-30(18-16-28)26(31)21-33-25-13-6-3-7-14-25/h2-14,19H,15-18,20-21H2,1H3,(H,29,32) |
| InChIKey | MMJSBDFVFIAVFS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |