C28H30N2O2 — CID 155982862
N-methyl-1-(2-phenylacetyl)-4-[(4-phenylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 155982862) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-methyl-1-(2-phenylacetyl)-4-[(4-phenylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-methyl-1-(2-phenylacetyl)-4-[(4-phenylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155982862 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-methyl-1-(2-phenylacetyl)-4-[(4-phenylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C1(Cc2ccc(-c3ccccc3)cc2)CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H30N2O2/c1-29-27(32)28(21-23-12-14-25(15-13-23)24-10-6-3-7-11-24)16-18-30(19-17-28)26(31)20-22-8-4-2-5-9-22/h2-15H,16-21H2,1H3,(H,29,32) |
| InChIKey | JGYBCHHEWSDENV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |