C20H26INO3 — CID 129362720
(2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-iodo-5-methoxyphenyl)propan-2-amine (PubChem CID 129362720) has the molecular formula C20H26INO3 and a molecular weight of 455.34 g/mol. Its IUPAC name is (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-iodo-5-methoxyphenyl)propan-2-amine.
| Compound Name | (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-iodo-5-methoxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 129362720 |
| Molecular Formula | C20H26INO3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-iodo-5-methoxyphenyl)propan-2-amine |
| SMILES | COc1ccc(I)c(C[C@@H](C)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H26INO3/c1-14(11-16-13-17(23-2)6-7-18(16)21)22-10-9-15-5-8-19(24-3)20(12-15)25-4/h5-8,12-14,22H,9-11H2,1-4H3/t14-/m1/s1 |
| InChIKey | AYEPYAIUSXQSLU-CQSZACIVSA-N |
| XLogP | 4.08 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|