C29H35NO3 — CID 67935590
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(E)-2-phenylethenyl]phenyl]butan-2-amine (PubChem CID 67935590) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(E)-2-phenylethenyl]phenyl]butan-2-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(E)-2-phenylethenyl]phenyl]butan-2-amine |
|---|---|
| PubChem CID | 67935590 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(E)-2-phenylethenyl]phenyl]butan-2-amine |
| SMILES | COc1ccc(/C=C/c2ccccc2)c(CCC(C)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C29H35NO3/c1-22(30-19-18-24-12-17-28(32-3)29(20-24)33-4)10-13-26-21-27(31-2)16-15-25(26)14-11-23-8-6-5-7-9-23/h5-9,11-12,14-17,20-22,30H,10,13,18-19H2,1-4H3/b14-11+ |
| InChIKey | YFYMJUPQZURXRZ-SDNWHVSQSA-N |
| XLogP | 6.04 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|