C30H37NO3 — CID 67935695
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine (PubChem CID 67935695) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 67935695 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine |
| SMILES | COc1ccc(/C=C\c2ccccc2)c(CCC(C)N(C)CCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C30H37NO3/c1-23(31(2)20-19-25-13-18-29(33-4)30(21-25)34-5)11-14-27-22-28(32-3)17-16-26(27)15-12-24-9-7-6-8-10-24/h6-10,12-13,15-18,21-23H,11,14,19-20H2,1-5H3/b15-12- |
| InChIKey | YJUODLGMPDGVOD-QINSGFPZSA-N |
| XLogP | 6.38 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|