C21H27NO3 — CID 927476
2-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethenyl]phenyl]-N,N-dimethylethanamine (PubChem CID 927476) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethenyl]phenyl]-N,N-dimethylethanamine.
| Compound Name | 2-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethenyl]phenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 927476 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethenyl]phenyl]-N,N-dimethylethanamine |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)cc2CCN(C)C)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-22(2)13-12-18-15-21(25-5)20(24-4)14-17(18)9-6-16-7-10-19(23-3)11-8-16/h6-11,14-15H,12-13H2,1-5H3 |
| InChIKey | CDEUAIWZABREND-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|