C30H37NO3 — CID 67935744
4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine (PubChem CID 67935744) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is 4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine.
| Compound Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 67935744 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxy-2-[(Z)-2-phenylethenyl]phenyl]-N-methylbutan-2-amine |
| SMILES | CNC(C)CCc1cc(OC)cc(CCc2ccc(OC)c(OC)c2)c1/C=C\c1ccccc1 |
| InChI | InChI=1S/C30H37NO3/c1-22(31-2)11-15-25-20-27(32-3)21-26(28(25)17-13-23-9-7-6-8-10-23)16-12-24-14-18-29(33-4)30(19-24)34-5/h6-10,13-14,17-22,31H,11-12,15-16H2,1-5H3/b17-13- |
| InChIKey | LYXXHMUXOGPIHP-LGMDPLHJSA-N |
| XLogP | 6.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|