C28H32NO2+ — CID 7323689
2-(3,4-dimethoxyphenyl)ethyl-bis[(E)-3-phenylprop-2-enyl]azanium (PubChem CID 7323689) has the molecular formula C28H32NO2+ and a molecular weight of 414.57 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-bis[(E)-3-phenylprop-2-enyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-bis[(E)-3-phenylprop-2-enyl]azanium |
|---|---|
| PubChem CID | 7323689 |
| Molecular Formula | C28H32NO2+ |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-bis[(E)-3-phenylprop-2-enyl]azanium |
| SMILES | COc1ccc(CC[NH+](C/C=C/c2ccccc2)C/C=C/c2ccccc2)cc1OC |
| InChI | InChI=1S/C28H31NO2/c1-30-27-18-17-26(23-28(27)31-2)19-22-29(20-9-15-24-11-5-3-6-12-24)21-10-16-25-13-7-4-8-14-25/h3-18,23H,19-22H2,1-2H3/p+1/b15-9+,16-10+ |
| InChIKey | DGMKTUPPIQWSRM-KAVGSWPWSA-O |
| XLogP | 4.56 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |