C20H22N3O3+ — CID 170909177
3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(E)-2-phenylethenyl]oxadiazol-3-ium-5-amine (PubChem CID 170909177) has the molecular formula C20H22N3O3+ and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(E)-2-phenylethenyl]oxadiazol-3-ium-5-amine.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(E)-2-phenylethenyl]oxadiazol-3-ium-5-amine |
|---|---|
| PubChem CID | 170909177 |
| Molecular Formula | C20H22N3O3+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(E)-2-phenylethenyl]oxadiazol-3-ium-5-amine |
| SMILES | COc1ccc(CC[n+]2noc(N)c2/C=C/c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H22N3O3/c1-24-18-11-9-16(14-19(18)25-2)12-13-23-17(20(21)26-22-23)10-8-15-6-4-3-5-7-15/h3-11,14H,12-13,21H2,1-2H3/q+1/b10-8+ |
| InChIKey | LYIYHFXWEQSCIO-CSKARUKUSA-N |
| XLogP | 2.97 |
| TPSA | 74.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|