C22H28NO4+ — CID 7323736
2-(3,4-dimethoxyphenyl)ethyl-bis[(5-methylfuran-2-yl)methyl]azanium (PubChem CID 7323736) has the molecular formula C22H28NO4+ and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-bis[(5-methylfuran-2-yl)methyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-bis[(5-methylfuran-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 7323736 |
| Molecular Formula | C22H28NO4+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-bis[(5-methylfuran-2-yl)methyl]azanium |
| SMILES | COc1ccc(CC[NH+](Cc2ccc(C)o2)Cc2ccc(C)o2)cc1OC |
| InChI | InChI=1S/C22H27NO4/c1-16-5-8-19(26-16)14-23(15-20-9-6-17(2)27-20)12-11-18-7-10-21(24-3)22(13-18)25-4/h5-10,13H,11-12,14-15H2,1-4H3/p+1 |
| InChIKey | CYQQPFWMPLQENJ-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |