C15H22N2O3S2 — CID 129370727
(2R)-N-[3-(cyclopropylsulfamoyl)-2-methylphenyl]-2-methyl-3-methylsulfanylpropanamide (PubChem CID 129370727) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (2R)-N-[3-(cyclopropylsulfamoyl)-2-methylphenyl]-2-methyl-3-methylsulfanylpropanamide.
| Compound Name | (2R)-N-[3-(cyclopropylsulfamoyl)-2-methylphenyl]-2-methyl-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 129370727 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2R)-N-[3-(cyclopropylsulfamoyl)-2-methylphenyl]-2-methyl-3-methylsulfanylpropanamide |
| SMILES | CSC[C@H](C)C(=O)Nc1cccc(S(=O)(=O)NC2CC2)c1C |
| InChI | InChI=1S/C15H22N2O3S2/c1-10(9-21-3)15(18)16-13-5-4-6-14(11(13)2)22(19,20)17-12-7-8-12/h4-6,10,12,17H,7-9H2,1-3H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | SASZHXOBGRAAQB-JTQLQIEISA-N |
| XLogP | 2.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |