C16H15N3OS2 — CID 129370832
(2S)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-(4-methylsulfanylphenyl)propanamide (PubChem CID 129370832) has the molecular formula C16H15N3OS2 and a molecular weight of 329.45 g/mol. Its IUPAC name is (2S)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-(4-methylsulfanylphenyl)propanamide.
| Compound Name | (2S)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-(4-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 129370832 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (2S)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-(4-methylsulfanylphenyl)propanamide |
| SMILES | CSc1ccc(NC(=O)[C@H](C)Sc2cc(C#N)ccn2)cc1 |
| InChI | InChI=1S/C16H15N3OS2/c1-11(22-15-9-12(10-17)7-8-18-15)16(20)19-13-3-5-14(21-2)6-4-13/h3-9,11H,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | IISVMLIKPMTTPN-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |