C17H16FN3OS — CID 129370764
(2R)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]propanamide (PubChem CID 129370764) has the molecular formula C17H16FN3OS and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]propanamide.
| Compound Name | (2R)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 129370764 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (2R)-2-[(4-cyano-2-pyridinyl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]propanamide |
| SMILES | C[C@@H](Sc1cc(C#N)ccn1)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3OS/c1-12(23-16-10-14(11-19)7-8-20-16)17(22)21-9-6-13-2-4-15(18)5-3-13/h2-5,7-8,10,12H,6,9H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | VYRVGUGPFBQBED-GFCCVEGCSA-N |
| XLogP | 2.93 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |