C16H17N3O3S — CID 97030696
(2S)-N-[2-(4-nitrophenyl)ethyl]-2-pyridin-2-ylsulfanylpropanamide (PubChem CID 97030696) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is (2S)-N-[2-(4-nitrophenyl)ethyl]-2-pyridin-2-ylsulfanylpropanamide.
| Compound Name | (2S)-N-[2-(4-nitrophenyl)ethyl]-2-pyridin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 97030696 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (2S)-N-[2-(4-nitrophenyl)ethyl]-2-pyridin-2-ylsulfanylpropanamide |
| SMILES | C[C@H](Sc1ccccn1)C(=O)NCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17N3O3S/c1-12(23-15-4-2-3-10-17-15)16(20)18-11-9-13-5-7-14(8-6-13)19(21)22/h2-8,10,12H,9,11H2,1H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | GMQDGOUDYIEMFM-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|