C18H23FN4O2 — CID 129370928
1-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-(oxan-4-yl)urea (PubChem CID 129370928) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 129370928 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-(oxan-4-yl)urea |
| SMILES | Cc1c([C@H](C)NC(=O)NC2CCOCC2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN4O2/c1-12(21-18(24)22-15-7-9-25-10-8-15)17-11-20-23(13(17)2)16-5-3-14(19)4-6-16/h3-6,11-12,15H,7-10H2,1-2H3,(H2,21,22,24)/t12-/m0/s1 |
| InChIKey | QDRWRWZAOSXEHI-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |