About N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine
N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine (PubChem CID 45167612) has the molecular formula C17H21F2N3O
and a molecular weight of 321.37 g/mol. Its IUPAC name is N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine.
Molecular Properties
| Compound Name | N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine |
| PubChem CID | 45167612 |
| Molecular Formula | C17H21F2N3O |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine |
| SMILES | Cc1c(C(C)NC2CCOCC2)cnn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C17H21F2N3O/c1-11(21-14-5-7-23-8-6-14)15-10-20-22(12(15)2)17-4-3-13(18)9-16(17)19/h3-4,9-11,14,21H,5-8H2,1-2H3 |
| InChIKey | YWCPSDVDOIZGCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine?
The IUPAC name of N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine (CID 45167612) is N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine.
What is the SMILES notation for N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine?
The canonical SMILES for N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine is Cc1c(C(C)NC2CCOCC2)cnn1-c1ccc(F)cc1F.
What is the InChIKey of N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine?
The InChIKey is YWCPSDVDOIZGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O/c1-11(21-14-5-7-23-8-6-14)15-10-20-22(12(15)2)17-4-3-13(18)9-16(17)19/h3-4,9-11,14,21H,5-8H2,1-2H3.
What are the key properties of N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine?
N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine has a molecular weight of 321.37 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]oxan-4-amine is sourced from PubChem (CID 45167612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).