C11H9BrF2N2 — CID 66439230
4-(bromomethyl)-1-(2,4-difluorophenyl)-5-methylpyrazole (PubChem CID 66439230) has the molecular formula C11H9BrF2N2 and a molecular weight of 287.11 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2,4-difluorophenyl)-5-methylpyrazole.
| Compound Name | 4-(bromomethyl)-1-(2,4-difluorophenyl)-5-methylpyrazole |
|---|---|
| PubChem CID | 66439230 |
| Molecular Formula | C11H9BrF2N2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 4-(bromomethyl)-1-(2,4-difluorophenyl)-5-methylpyrazole |
| SMILES | Cc1c(CBr)cnn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C11H9BrF2N2/c1-7-8(5-12)6-15-16(7)11-3-2-9(13)4-10(11)14/h2-4,6H,5H2,1H3 |
| InChIKey | KSCWIGIVJYCNGY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|