C14H19FN2O2 — CID 129371703
tert-butyl (3R)-1-(3-fluoro-2-pyridinyl)pyrrolidine-3-carboxylate (PubChem CID 129371703) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is tert-butyl (3R)-1-(3-fluoro-2-pyridinyl)pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3R)-1-(3-fluoro-2-pyridinyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 129371703 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | tert-butyl (3R)-1-(3-fluoro-2-pyridinyl)pyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCN(c2ncccc2F)C1 |
| InChI | InChI=1S/C14H19FN2O2/c1-14(2,3)19-13(18)10-6-8-17(9-10)12-11(15)5-4-7-16-12/h4-5,7,10H,6,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | VPQZBNWNGKWJQI-SNVBAGLBSA-N |
| XLogP | 2.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |