C20H33NO4 — CID 129373015
tert-butyl (4aR,7Z,8aS)-7-(4-ethoxy-4-oxobutylidene)-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate (PubChem CID 129373015) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl (4aR,7Z,8aS)-7-(4-ethoxy-4-oxobutylidene)-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate.
| Compound Name | tert-butyl (4aR,7Z,8aS)-7-(4-ethoxy-4-oxobutylidene)-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 129373015 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl (4aR,7Z,8aS)-7-(4-ethoxy-4-oxobutylidene)-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)CC/C=C1/CC[C@@H]2CCCN(C(=O)OC(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C20H33NO4/c1-5-24-18(22)10-6-8-15-11-12-16-9-7-13-21(17(16)14-15)19(23)25-20(2,3)4/h8,16-17H,5-7,9-14H2,1-4H3/b15-8-/t16-,17-/m0/s1 |
| InChIKey | NSXKVQNHXBAKRT-LYXSOASSSA-N |
| XLogP | 4.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|