C17H29NO2 — CID 169258608
ethyl (4E)-4-[(4aS,8aR)-1-ethyl-2,3,4,4a,5,6,8,8a-octahydroquinolin-7-ylidene]butanoate (PubChem CID 169258608) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is ethyl (4E)-4-[(4aS,8aR)-1-ethyl-2,3,4,4a,5,6,8,8a-octahydroquinolin-7-ylidene]butanoate.
| Compound Name | ethyl (4E)-4-[(4aS,8aR)-1-ethyl-2,3,4,4a,5,6,8,8a-octahydroquinolin-7-ylidene]butanoate |
|---|---|
| PubChem CID | 169258608 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | ethyl (4E)-4-[(4aS,8aR)-1-ethyl-2,3,4,4a,5,6,8,8a-octahydroquinolin-7-ylidene]butanoate |
| SMILES | CCOC(=O)CC/C=C1\CC[C@H]2CCCN(CC)[C@@H]2C1 |
| InChI | InChI=1S/C17H29NO2/c1-3-18-12-6-8-15-11-10-14(13-16(15)18)7-5-9-17(19)20-4-2/h7,15-16H,3-6,8-13H2,1-2H3/b14-7+/t15-,16-/m1/s1 |
| InChIKey | ZWNTVVCRKWBFKV-DJYJQHBUSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|