C16H25NO2S — CID 129374172
N-[(1R,2R,4R)-2,4-dimethylcyclohexyl]-3-(methylsulfonylmethyl)aniline (PubChem CID 129374172) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[(1R,2R,4R)-2,4-dimethylcyclohexyl]-3-(methylsulfonylmethyl)aniline.
| Compound Name | N-[(1R,2R,4R)-2,4-dimethylcyclohexyl]-3-(methylsulfonylmethyl)aniline |
|---|---|
| PubChem CID | 129374172 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(1R,2R,4R)-2,4-dimethylcyclohexyl]-3-(methylsulfonylmethyl)aniline |
| SMILES | C[C@@H]1CC[C@@H](Nc2cccc(CS(C)(=O)=O)c2)[C@H](C)C1 |
| InChI | InChI=1S/C16H25NO2S/c1-12-7-8-16(13(2)9-12)17-15-6-4-5-14(10-15)11-20(3,18)19/h4-6,10,12-13,16-17H,7-9,11H2,1-3H3/t12-,13-,16-/m1/s1 |
| InChIKey | MOPWWKGZBFXLRV-XJKCOSOUSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |