C14H11F3N2O4 — CID 129374578
N-methyl-5-nitro-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]furan-2-carboxamide (PubChem CID 129374578) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is N-methyl-5-nitro-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]furan-2-carboxamide.
| Compound Name | N-methyl-5-nitro-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 129374578 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-methyl-5-nitro-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]furan-2-carboxamide |
| SMILES | CN(C(=O)c1ccc([N+](=O)[O-])o1)[C@@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H11F3N2O4/c1-18(13(20)10-7-8-11(23-10)19(21)22)12(14(15,16)17)9-5-3-2-4-6-9/h2-8,12H,1H3/t12-/m0/s1 |
| InChIKey | GIPGRXUQNHCGCO-LBPRGKRZSA-N |
| XLogP | 3.56 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|