C22H24N2O7 — CID 129377166
(3R,4R)-4-(2,4-dimethoxyphenyl)-3-(3-nitrophenoxy)-1-[[(2R)-oxolan-2-yl]methyl]azetidin-2-one (PubChem CID 129377166) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is (3R,4R)-4-(2,4-dimethoxyphenyl)-3-(3-nitrophenoxy)-1-[[(2R)-oxolan-2-yl]methyl]azetidin-2-one.
| Compound Name | (3R,4R)-4-(2,4-dimethoxyphenyl)-3-(3-nitrophenoxy)-1-[[(2R)-oxolan-2-yl]methyl]azetidin-2-one |
|---|---|
| PubChem CID | 129377166 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (3R,4R)-4-(2,4-dimethoxyphenyl)-3-(3-nitrophenoxy)-1-[[(2R)-oxolan-2-yl]methyl]azetidin-2-one |
| SMILES | COc1ccc([C@@H]2[C@@H](Oc3cccc([N+](=O)[O-])c3)C(=O)N2C[C@H]2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O7/c1-28-15-8-9-18(19(12-15)29-2)20-21(22(25)23(20)13-17-7-4-10-30-17)31-16-6-3-5-14(11-16)24(26)27/h3,5-6,8-9,11-12,17,20-21H,4,7,10,13H2,1-2H3/t17-,20-,21-/m1/s1 |
| InChIKey | NKQSYAQTRNSYMG-DUXKGJEZSA-N |
| XLogP | 3.12 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|