C20H21N3O6 — CID 25355991
(2R)-2-(4-hydroxy-5-methoxy-2-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one (PubChem CID 25355991) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is (2R)-2-(4-hydroxy-5-methoxy-2-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-(4-hydroxy-5-methoxy-2-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 25355991 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (2R)-2-(4-hydroxy-5-methoxy-2-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one |
| SMILES | COc1cc([C@@H]2Nc3ccccc3C(=O)N2C[C@@H]2CCCO2)c([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C20H21N3O6/c1-28-18-9-14(16(23(26)27)10-17(18)24)19-21-15-7-3-2-6-13(15)20(25)22(19)11-12-5-4-8-29-12/h2-3,6-7,9-10,12,19,21,24H,4-5,8,11H2,1H3/t12-,19+/m0/s1 |
| InChIKey | PIGPWDQEVKSTND-HXPMCKFVSA-N |
| XLogP | 3.05 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|