C19H18ClN3O4 — CID 25359600
(2R)-2-(2-chloro-5-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one (PubChem CID 25359600) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is (2R)-2-(2-chloro-5-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-(2-chloro-5-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 25359600 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (2R)-2-(2-chloro-5-nitrophenyl)-3-[[(2S)-oxolan-2-yl]methyl]-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2cc([N+](=O)[O-])ccc2Cl)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H18ClN3O4/c20-16-8-7-12(23(25)26)10-15(16)18-21-17-6-2-1-5-14(17)19(24)22(18)11-13-4-3-9-27-13/h1-2,5-8,10,13,18,21H,3-4,9,11H2/t13-,18+/m0/s1 |
| InChIKey | SWCQDWHGCOEWEF-SCLBCKFNSA-N |
| XLogP | 3.99 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|