C20H24N2O — CID 129378896
(4aS,8aS)-6-[(3-pyridin-3-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 129378896) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (4aS,8aS)-6-[(3-pyridin-3-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aS)-6-[(3-pyridin-3-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 129378896 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (4aS,8aS)-6-[(3-pyridin-3-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | c1cncc(-c2cccc(CN3CC[C@@H]4OCCC[C@H]4C3)c2)c1 |
| InChI | InChI=1S/C20H24N2O/c1-4-16(12-17(5-1)18-6-2-9-21-13-18)14-22-10-8-20-19(15-22)7-3-11-23-20/h1-2,4-6,9,12-13,19-20H,3,7-8,10-11,14-15H2/t19-,20-/m0/s1 |
| InChIKey | FWHWKMMKKANTJE-PMACEKPBSA-N |
| XLogP | 3.75 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |