C26H40N2O2 — CID 166231686
4-(oxolan-2-yl)-1-[[3-[[4-(oxolan-2-yl)piperidin-1-yl]methyl]phenyl]methyl]piperidine (PubChem CID 166231686) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-1-[[3-[[4-(oxolan-2-yl)piperidin-1-yl]methyl]phenyl]methyl]piperidine.
| Compound Name | 4-(oxolan-2-yl)-1-[[3-[[4-(oxolan-2-yl)piperidin-1-yl]methyl]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 166231686 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 4-(oxolan-2-yl)-1-[[3-[[4-(oxolan-2-yl)piperidin-1-yl]methyl]phenyl]methyl]piperidine |
| SMILES | c1cc(CN2CCC(C3CCCO3)CC2)cc(CN2CCC(C3CCCO3)CC2)c1 |
| InChI | InChI=1S/C26H40N2O2/c1-4-21(19-27-12-8-23(9-13-27)25-6-2-16-29-25)18-22(5-1)20-28-14-10-24(11-15-28)26-7-3-17-30-26/h1,4-5,18,23-26H,2-3,6-17,19-20H2 |
| InChIKey | SNORHSBIQAIMEL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |