About 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine
1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine (PubChem CID 138503515) has the molecular formula C19H30N2O
and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine |
| PubChem CID | 138503515 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine |
| SMILES | C1COC(N2CCCC2)C1.c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C8H15NO/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-2-6-9(5-1)8-4-3-7-10-8/h1-3,6-7H,4-5,8-10H2;8H,1-7H2 |
| InChIKey | SUNDADINLZDNJL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine?
The IUPAC name of 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine (CID 138503515) is 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine.
What is the SMILES notation for 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine?
The canonical SMILES for 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine is C1COC(N2CCCC2)C1.c1ccc(CN2CCCC2)cc1.
What is the InChIKey of 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine?
The InChIKey is SUNDADINLZDNJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C8H15NO/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-2-6-9(5-1)8-4-3-7-10-8/h1-3,6-7H,4-5,8-10H2;8H,1-7H2.
What are the key properties of 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine?
1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine has a molecular weight of 302.46 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrrolidine;1-(oxolan-2-yl)pyrrolidine is sourced from PubChem (CID 138503515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).