C18H26N2O3S — CID 97056256
S-[3-[[(2S)-2-[(2S)-oxolan-2-yl]morpholin-4-yl]methyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 97056256) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is S-[3-[[(2S)-2-[(2S)-oxolan-2-yl]morpholin-4-yl]methyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[3-[[(2S)-2-[(2S)-oxolan-2-yl]morpholin-4-yl]methyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 97056256 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | S-[3-[[(2S)-2-[(2S)-oxolan-2-yl]morpholin-4-yl]methyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1cccc(CN2CCO[C@H]([C@@H]3CCCO3)C2)c1 |
| InChI | InChI=1S/C18H26N2O3S/c1-19(2)18(21)24-15-6-3-5-14(11-15)12-20-8-10-23-17(13-20)16-7-4-9-22-16/h3,5-6,11,16-17H,4,7-10,12-13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | QGORAVJXKGWRIU-IRXDYDNUSA-N |
| XLogP | 2.84 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|