C13H18BrNO3 — CID 99832542
(2R)-4-[(5-bromofuran-2-yl)methyl]-2-[(2S)-oxolan-2-yl]morpholine (PubChem CID 99832542) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is (2R)-4-[(5-bromofuran-2-yl)methyl]-2-[(2S)-oxolan-2-yl]morpholine.
| Compound Name | (2R)-4-[(5-bromofuran-2-yl)methyl]-2-[(2S)-oxolan-2-yl]morpholine |
|---|---|
| PubChem CID | 99832542 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (2R)-4-[(5-bromofuran-2-yl)methyl]-2-[(2S)-oxolan-2-yl]morpholine |
| SMILES | Brc1ccc(CN2CCO[C@@H]([C@@H]3CCCO3)C2)o1 |
| InChI | InChI=1S/C13H18BrNO3/c14-13-4-3-10(18-13)8-15-5-7-17-12(9-15)11-2-1-6-16-11/h3-4,11-12H,1-2,5-9H2/t11-,12+/m0/s1 |
| InChIKey | OBUSVIRSOKLVLS-NWDGAFQWSA-N |
| XLogP | 2.42 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |