C15H21F2NO3S — CID 84594245
4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(oxolan-2-yl)morpholine (PubChem CID 84594245) has the molecular formula C15H21F2NO3S and a molecular weight of 333.40 g/mol. Its IUPAC name is 4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(oxolan-2-yl)morpholine.
| Compound Name | 4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(oxolan-2-yl)morpholine |
|---|---|
| PubChem CID | 84594245 |
| Molecular Formula | C15H21F2NO3S |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(oxolan-2-yl)morpholine |
| SMILES | FC(F)SCc1ccc(CN2CCOC(C3CCCO3)C2)o1 |
| InChI | InChI=1S/C15H21F2NO3S/c16-15(17)22-10-12-4-3-11(21-12)8-18-5-7-20-14(9-18)13-2-1-6-19-13/h3-4,13-15H,1-2,5-10H2 |
| InChIKey | WRLXGRCNBDGAAY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |