C17H25NO3 — CID 129378923
(3S)-N-[(1S,2R)-2-(2-ethoxyphenoxy)cyclopentyl]oxolan-3-amine (PubChem CID 129378923) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3S)-N-[(1S,2R)-2-(2-ethoxyphenoxy)cyclopentyl]oxolan-3-amine.
| Compound Name | (3S)-N-[(1S,2R)-2-(2-ethoxyphenoxy)cyclopentyl]oxolan-3-amine |
|---|---|
| PubChem CID | 129378923 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3S)-N-[(1S,2R)-2-(2-ethoxyphenoxy)cyclopentyl]oxolan-3-amine |
| SMILES | CCOc1ccccc1O[C@@H]1CCC[C@@H]1N[C@H]1CCOC1 |
| InChI | InChI=1S/C17H25NO3/c1-2-20-16-7-3-4-8-17(16)21-15-9-5-6-14(15)18-13-10-11-19-12-13/h3-4,7-8,13-15,18H,2,5-6,9-12H2,1H3/t13-,14-,15+/m0/s1 |
| InChIKey | SMEQUXUGXUJYAP-SOUVJXGZSA-N |
| XLogP | 2.76 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |