C14H21NO3 — CID 80713225
N-[(3-ethoxy-2-methoxyphenyl)methyl]oxolan-3-amine (PubChem CID 80713225) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(3-ethoxy-2-methoxyphenyl)methyl]oxolan-3-amine.
| Compound Name | N-[(3-ethoxy-2-methoxyphenyl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 80713225 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[(3-ethoxy-2-methoxyphenyl)methyl]oxolan-3-amine |
| SMILES | CCOc1cccc(CNC2CCOC2)c1OC |
| InChI | InChI=1S/C14H21NO3/c1-3-18-13-6-4-5-11(14(13)16-2)9-15-12-7-8-17-10-12/h4-6,12,15H,3,7-10H2,1-2H3 |
| InChIKey | HAHQUYUEUGAYTA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |