C14H23N3O — CID 129378975
N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(3-methoxypropyl)pyrazol-3-amine (PubChem CID 129378975) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(3-methoxypropyl)pyrazol-3-amine.
| Compound Name | N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(3-methoxypropyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 129378975 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(3-methoxypropyl)pyrazol-3-amine |
| SMILES | COCCCn1ccc(N[C@@H]2C[C@H]3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C14H23N3O/c1-18-8-2-6-17-7-5-14(16-17)15-13-10-11-3-4-12(13)9-11/h5,7,11-13H,2-4,6,8-10H2,1H3,(H,15,16)/t11-,12-,13+/m0/s1 |
| InChIKey | FIAPMQAOAHHSTA-RWMBFGLXSA-N |
| XLogP | 2.52 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|