C11H21NO — CID 6594927
(1R,2S,4S)-N-(3-methoxypropyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 6594927) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (1R,2S,4S)-N-(3-methoxypropyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2S,4S)-N-(3-methoxypropyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 6594927 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (1R,2S,4S)-N-(3-methoxypropyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | COCCCN[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H21NO/c1-13-6-2-5-12-11-8-9-3-4-10(11)7-9/h9-12H,2-8H2,1H3/t9-,10+,11-/m0/s1 |
| InChIKey | HNZZYTWEVTVZQF-AXFHLTTASA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|