C12H23N — CID 124526640
(1S,2R,4S)-N-pentylbicyclo[2.2.1]heptan-2-amine (PubChem CID 124526640) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (1S,2R,4S)-N-pentylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1S,2R,4S)-N-pentylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 124526640 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (1S,2R,4S)-N-pentylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CCCCCN[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H23N/c1-2-3-4-7-13-12-9-10-5-6-11(12)8-10/h10-13H,2-9H2,1H3/t10-,11-,12+/m0/s1 |
| InChIKey | GOYUSDMNNAVPEX-SDDRHHMPSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|