C10H20N2 — CID 61309746
N'-(2-bicyclo[2.2.1]heptanyl)propane-1,3-diamine (PubChem CID 61309746) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-(2-bicyclo[2.2.1]heptanyl)propane-1,3-diamine.
| Compound Name | N'-(2-bicyclo[2.2.1]heptanyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 61309746 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-(2-bicyclo[2.2.1]heptanyl)propane-1,3-diamine |
| SMILES | NCCCNC1CC2CCC1C2 |
| InChI | InChI=1S/C10H20N2/c11-4-1-5-12-10-7-8-2-3-9(10)6-8/h8-10,12H,1-7,11H2 |
| InChIKey | NBUOEIMVUSRUBB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|