C10H21NO — CID 95377511
trans-(1R,2R)-N-(3-methoxypropyl)-2-methylcyclopentan-1-amine (PubChem CID 95377511) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is trans-(1R,2R)-N-(3-methoxypropyl)-2-methylcyclopentan-1-amine.
| Compound Name | trans-(1R,2R)-N-(3-methoxypropyl)-2-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 95377511 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | trans-(1R,2R)-N-(3-methoxypropyl)-2-methylcyclopentan-1-amine |
| SMILES | COCCCN[C@@H]1CCC[C@H]1C |
| InChI | InChI=1S/C10H21NO/c1-9-5-3-6-10(9)11-7-4-8-12-2/h9-11H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | YBBFARUHKVMGCY-NXEZZACHSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|