C14H29NO2 — CID 43183035
N-[3-(2-methoxyethoxy)propyl]-2,6-dimethylcyclohexan-1-amine (PubChem CID 43183035) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-2,6-dimethylcyclohexan-1-amine.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-2,6-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43183035 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-2,6-dimethylcyclohexan-1-amine |
| SMILES | COCCOCCCNC1C(C)CCCC1C |
| InChI | InChI=1S/C14H29NO2/c1-12-6-4-7-13(2)14(12)15-8-5-9-17-11-10-16-3/h12-15H,4-11H2,1-3H3 |
| InChIKey | SHDZHKYAFCDPOS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|