C13H27NO2 — CID 103409528
N-[3-(2-methoxyethoxy)propyl]-2,3-dimethylcyclopentan-1-amine (PubChem CID 103409528) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-2,3-dimethylcyclopentan-1-amine.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-2,3-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 103409528 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-2,3-dimethylcyclopentan-1-amine |
| SMILES | COCCOCCCNC1CCC(C)C1C |
| InChI | InChI=1S/C13H27NO2/c1-11-5-6-13(12(11)2)14-7-4-8-16-10-9-15-3/h11-14H,4-10H2,1-3H3 |
| InChIKey | LNRFIRDPRXHYDN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|