C14H29NO — CID 28673271
cis-(1R,2R)-2-tert-butyl-N-(3-methoxypropyl)cyclohexan-1-amine (PubChem CID 28673271) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is cis-(1R,2R)-2-tert-butyl-N-(3-methoxypropyl)cyclohexan-1-amine.
| Compound Name | cis-(1R,2R)-2-tert-butyl-N-(3-methoxypropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 28673271 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | cis-(1R,2R)-2-tert-butyl-N-(3-methoxypropyl)cyclohexan-1-amine |
| SMILES | COCCCN[C@@H]1CCCC[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C14H29NO/c1-14(2,3)12-8-5-6-9-13(12)15-10-7-11-16-4/h12-13,15H,5-11H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | AYDTWUUWGLTJAT-QWHCGFSZSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|