About (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid
(3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 129379117) has the molecular formula C13H15F3N2O3
and a molecular weight of 304.27 g/mol. Its IUPAC name is (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 129379117 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc(C(=O)N2CC[C@](C(=O)O)(C(F)(F)F)C2)n1C |
| InChI | InChI=1S/C13H15F3N2O3/c1-8-3-4-9(17(8)2)10(19)18-6-5-12(7-18,11(20)21)13(14,15)16/h3-4H,5-7H2,1-2H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | KPCWRWRVAHUJJB-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (CID 129379117) is (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid is Cc1ccc(C(=O)N2CC[C@](C(=O)O)(C(F)(F)F)C2)n1C.
What is the InChIKey of (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid?
The InChIKey is KPCWRWRVAHUJJB-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H15F3N2O3/c1-8-3-4-9(17(8)2)10(19)18-6-5-12(7-18,11(20)21)13(14,15)16/h3-4H,5-7H2,1-2H3,(H,20,21)/t12-/m0/s1.
What are the key properties of (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid?
(3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid has a molecular weight of 304.27 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(1,5-dimethylpyrrole-2-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 129379117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).