C18H15F3N2O2 — CID 129380147
2-cyano-N-[(R)-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 129380147) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-cyano-N-[(R)-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-cyano-N-[(R)-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 129380147 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-cyano-N-[(R)-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | COc1ccc([C@H](NC(=O)CC#N)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-25-15-8-4-13(5-9-15)17(23-16(24)10-11-22)12-2-6-14(7-3-12)18(19,20)21/h2-9,17H,10H2,1H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | CZEIJXQCNAEQTE-QGZVFWFLSA-N |
| XLogP | 3.83 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |