About [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate
[(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate (PubChem CID 54165205) has the molecular formula C14H12N2O5
and a molecular weight of 288.26 g/mol. Its IUPAC name is [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate.
Molecular Properties
| Compound Name | [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate |
| PubChem CID | 54165205 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate |
| SMILES | COc1ccc(C(OC(=O)CC#N)OC(=O)CC#N)cc1 |
| InChI | InChI=1S/C14H12N2O5/c1-19-11-4-2-10(3-5-11)14(20-12(17)6-8-15)21-13(18)7-9-16/h2-5,14H,6-7H2,1H3 |
| InChIKey | OREDNJGBMWFLQY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate?
The IUPAC name of [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate (CID 54165205) is [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate.
What is the SMILES notation for [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate?
The canonical SMILES for [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate is COc1ccc(C(OC(=O)CC#N)OC(=O)CC#N)cc1.
What is the InChIKey of [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate?
The InChIKey is OREDNJGBMWFLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O5/c1-19-11-4-2-10(3-5-11)14(20-12(17)6-8-15)21-13(18)7-9-16/h2-5,14H,6-7H2,1H3.
What are the key properties of [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate?
[(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate has a molecular weight of 288.26 g/mol, XLogP of 1.61, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-cyanoacetyl)oxy-(4-methoxyphenyl)methyl] 2-cyanoacetate is sourced from PubChem (CID 54165205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).