C14H17ClN2O3S — CID 129382032
(4aR,8aS)-1-[(5-chloro-2-nitrophenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine (PubChem CID 129382032) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is (4aR,8aS)-1-[(5-chloro-2-nitrophenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine.
| Compound Name | (4aR,8aS)-1-[(5-chloro-2-nitrophenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
|---|---|
| PubChem CID | 129382032 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (4aR,8aS)-1-[(5-chloro-2-nitrophenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1CN1CCS[C@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C14H17ClN2O3S/c15-11-1-2-12(17(18)19)10(7-11)8-16-4-6-21-14-9-20-5-3-13(14)16/h1-2,7,13-14H,3-6,8-9H2/t13-,14-/m0/s1 |
| InChIKey | XQBBZFKZMUSCNQ-KBPBESRZSA-N |
| XLogP | 2.95 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|