C17H18O3S — CID 129383502
(2R,3S)-2-(acetylsulfanylmethyl)-3-naphthalen-2-ylbutanoic acid (PubChem CID 129383502) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is (2R,3S)-2-(acetylsulfanylmethyl)-3-naphthalen-2-ylbutanoic acid.
| Compound Name | (2R,3S)-2-(acetylsulfanylmethyl)-3-naphthalen-2-ylbutanoic acid |
|---|---|
| PubChem CID | 129383502 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2R,3S)-2-(acetylsulfanylmethyl)-3-naphthalen-2-ylbutanoic acid |
| SMILES | CC(=O)SC[C@@H](C(=O)O)[C@H](C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18O3S/c1-11(16(17(19)20)10-21-12(2)18)14-8-7-13-5-3-4-6-15(13)9-14/h3-9,11,16H,10H2,1-2H3,(H,19,20)/t11-,16-/m1/s1 |
| InChIKey | VFABKFPGWMWHHY-BDJLRTHQSA-N |
| XLogP | 3.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|