C15H18ClNO2 — CID 70202945
3-amino-3-methyl-2-naphthalen-2-ylbutanoic acid;hydrochloride (PubChem CID 70202945) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-amino-3-methyl-2-naphthalen-2-ylbutanoic acid;hydrochloride.
| Compound Name | 3-amino-3-methyl-2-naphthalen-2-ylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70202945 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-amino-3-methyl-2-naphthalen-2-ylbutanoic acid;hydrochloride |
| SMILES | CC(C)(N)C(C(=O)O)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C15H17NO2.ClH/c1-15(2,16)13(14(17)18)12-8-7-10-5-3-4-6-11(10)9-12;/h3-9,13H,16H2,1-2H3,(H,17,18);1H |
| InChIKey | XMDSCQBJHHRNHB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |