C17H20N2O3 — CID 141117162
2-[(1R)-2-hydroxy-2-methyl-1-naphthalen-2-ylpropyl]propanediamide (PubChem CID 141117162) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[(1R)-2-hydroxy-2-methyl-1-naphthalen-2-ylpropyl]propanediamide.
| Compound Name | 2-[(1R)-2-hydroxy-2-methyl-1-naphthalen-2-ylpropyl]propanediamide |
|---|---|
| PubChem CID | 141117162 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[(1R)-2-hydroxy-2-methyl-1-naphthalen-2-ylpropyl]propanediamide |
| SMILES | CC(C)(O)[C@@H](c1ccc2ccccc2c1)C(C(N)=O)C(N)=O |
| InChI | InChI=1S/C17H20N2O3/c1-17(2,22)14(13(15(18)20)16(19)21)12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13-14,22H,1-2H3,(H2,18,20)(H2,19,21)/t14-/m0/s1 |
| InChIKey | UYSABQRHRIOBFV-AWEZNQCLSA-N |
| XLogP | 1.28 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|