C15H20O2S — CID 129383928
(1S)-4-ethyl-1-(4-methylsulfanylphenyl)hex-2-yne-1,4-diol (PubChem CID 129383928) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is (1S)-4-ethyl-1-(4-methylsulfanylphenyl)hex-2-yne-1,4-diol.
| Compound Name | (1S)-4-ethyl-1-(4-methylsulfanylphenyl)hex-2-yne-1,4-diol |
|---|---|
| PubChem CID | 129383928 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1S)-4-ethyl-1-(4-methylsulfanylphenyl)hex-2-yne-1,4-diol |
| SMILES | CCC(O)(C#C[C@@H](O)c1ccc(SC)cc1)CC |
| InChI | InChI=1S/C15H20O2S/c1-4-15(17,5-2)11-10-14(16)12-6-8-13(18-3)9-7-12/h6-9,14,16-17H,4-5H2,1-3H3/t14-/m1/s1 |
| InChIKey | RUDKLXQGQIFXLR-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|