C20H30N2 — CID 129384489
1-[(1S,5S)-3-bicyclo[3.2.1]octanyl]-4-(2,5-dimethylphenyl)piperazine (PubChem CID 129384489) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-[(1S,5S)-3-bicyclo[3.2.1]octanyl]-4-(2,5-dimethylphenyl)piperazine.
| Compound Name | 1-[(1S,5S)-3-bicyclo[3.2.1]octanyl]-4-(2,5-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 129384489 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 1-[(1S,5S)-3-bicyclo[3.2.1]octanyl]-4-(2,5-dimethylphenyl)piperazine |
| SMILES | Cc1ccc(C)c(N2CCN(C3C[C@H]4CC[C@H](C3)C4)CC2)c1 |
| InChI | InChI=1S/C20H30N2/c1-15-3-4-16(2)20(11-15)22-9-7-21(8-10-22)19-13-17-5-6-18(12-17)14-19/h3-4,11,17-19H,5-10,12-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | LIRIKHDKWXXFIR-ROUUACIJSA-N |
| XLogP | 4.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |